C13H24N2OSi — CID 123931431
2-[4-[tert-butyl(dimethyl)silyl]oxy-2-iminocyclopentyl]acetonitrile (PubChem CID 123931431) has the molecular formula C13H24N2OSi and a molecular weight of 252.43 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-iminocyclopentyl]acetonitrile.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-iminocyclopentyl]acetonitrile |
|---|---|
| PubChem CID | 123931431 |
| Molecular Formula | C13H24N2OSi |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-iminocyclopentyl]acetonitrile |
| SMILES | [H]/N=C1\CC(O[Si](C)(C)C(C)(C)C)CC1CC#N |
| InChI | InChI=1S/C13H24N2OSi/c1-13(2,3)17(4,5)16-11-8-10(6-7-14)12(15)9-11/h10-11,15H,6,8-9H2,1-5H3/b15-12+ |
| InChIKey | PCJFMBOHQSXDDQ-NTCAYCPXSA-N |
| XLogP | 3.72 |
| TPSA | 56.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|