C13H15F — CID 123938657
1-fluoro-2,3,7-trimethyl-1,8a-dihydronaphthalene (PubChem CID 123938657) has the molecular formula C13H15F and a molecular weight of 190.26 g/mol. Its IUPAC name is 1-fluoro-2,3,7-trimethyl-1,8a-dihydronaphthalene.
| Compound Name | 1-fluoro-2,3,7-trimethyl-1,8a-dihydronaphthalene |
|---|---|
| PubChem CID | 123938657 |
| Molecular Formula | C13H15F |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-fluoro-2,3,7-trimethyl-1,8a-dihydronaphthalene |
| SMILES | CC1=CC2C(=CC(C)=C(C)C2F)C=C1 |
| InChI | InChI=1S/C13H15F/c1-8-4-5-11-7-9(2)10(3)13(14)12(11)6-8/h4-7,12-13H,1-3H3 |
| InChIKey | BAXFYBZMQTVVGY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |