C24H24ClFN4OS — CID 123942002
4-[[4-[[4-chloro-3-(2-fluoropropan-2-yl)phenyl]carbamothioylamino]phenyl]methyl]-N-methylpyridine-2-carboxamide (PubChem CID 123942002) has the molecular formula C24H24ClFN4OS and a molecular weight of 471.00 g/mol. Its IUPAC name is 4-[[4-[[4-chloro-3-(2-fluoropropan-2-yl)phenyl]carbamothioylamino]phenyl]methyl]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[[4-[[4-chloro-3-(2-fluoropropan-2-yl)phenyl]carbamothioylamino]phenyl]methyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 123942002 |
| Molecular Formula | C24H24ClFN4OS |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 4-[[4-[[4-chloro-3-(2-fluoropropan-2-yl)phenyl]carbamothioylamino]phenyl]methyl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Cc2ccc(NC(=S)Nc3ccc(Cl)c(C(C)(C)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C24H24ClFN4OS/c1-24(2,26)19-14-18(8-9-20(19)25)30-23(32)29-17-6-4-15(5-7-17)12-16-10-11-28-21(13-16)22(31)27-3/h4-11,13-14H,12H2,1-3H3,(H,27,31)(H2,29,30,32) |
| InChIKey | CEFXTWQVPBGEKN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|