C14H28SSi2 — CID 123949993
(5-dimethylsilyl-3,4-dipropylthiophen-2-yl)-dimethylsilane (PubChem CID 123949993) has the molecular formula C14H28SSi2 and a molecular weight of 284.62 g/mol. Its IUPAC name is (5-dimethylsilyl-3,4-dipropylthiophen-2-yl)-dimethylsilane.
| Compound Name | (5-dimethylsilyl-3,4-dipropylthiophen-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 123949993 |
| Molecular Formula | C14H28SSi2 |
| Molecular Weight | 284.62 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (5-dimethylsilyl-3,4-dipropylthiophen-2-yl)-dimethylsilane |
| SMILES | CCCc1c([SiH](C)C)sc([SiH](C)C)c1CCC |
| InChI | InChI=1S/C14H28SSi2/c1-7-9-11-12(10-8-2)14(17(5)6)15-13(11)16(3)4/h16-17H,7-10H2,1-6H3 |
| InChIKey | HHVMTCAVDZPLMJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|