C13H23N — CID 123951338
4-methyl-N-pentylhepta-1,6-dien-3-imine (PubChem CID 123951338) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 4-methyl-N-pentylhepta-1,6-dien-3-imine.
| Compound Name | 4-methyl-N-pentylhepta-1,6-dien-3-imine |
|---|---|
| PubChem CID | 123951338 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 4-methyl-N-pentylhepta-1,6-dien-3-imine |
| SMILES | C=CCC(C)/C(C=C)=N/CCCCC |
| InChI | InChI=1S/C13H23N/c1-5-8-9-11-14-13(7-3)12(4)10-6-2/h6-7,12H,2-3,5,8-11H2,1,4H3/b14-13+ |
| InChIKey | XLDJMGIAQNPDOY-BUHFOSPRSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|