C28H29N2O4+ — CID 123962774
2-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-4-(6-hydroxy-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-trien-7-ylidene)cyclobutane-1,3-dione (PubChem CID 123962774) has the molecular formula C28H29N2O4+ and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-4-(6-hydroxy-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-trien-7-ylidene)cyclobutane-1,3-dione.
| Compound Name | 2-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-4-(6-hydroxy-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-trien-7-ylidene)cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 123962774 |
| Molecular Formula | C28H29N2O4+ |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-4-(6-hydroxy-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-trien-7-ylidene)cyclobutane-1,3-dione |
| SMILES | O=C1C(=c2cc3c4c(c2O)CCC[N+]=4CCC3)C(=O)C1c1cc2c3c(c1O)CCCN3CCC2 |
| InChI | InChI=1S/C28H28N2O4/c31-25-17-7-3-11-29-9-1-5-15(23(17)29)13-19(25)21-27(33)22(28(21)34)20-14-16-6-2-10-30-12-4-8-18(24(16)30)26(20)32/h13-14,21,31H,1-12H2/p+1/b22-20- |
| InChIKey | DAXXKLPGKNBLGR-XDOYNYLZSA-O |
| XLogP | 1.27 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|