C29H31N2O5+ — CID 91478717
4-hydroxy-5-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-2-(6-hydroxy-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-trien-7-ylidene)cyclopentane-1,3-dione (PubChem CID 91478717) has the molecular formula C29H31N2O5+ and a molecular weight of 487.58 g/mol. Its IUPAC name is 4-hydroxy-5-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-2-(6-hydroxy-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-trien-7-ylidene)cyclopentane-1,3-dione.
| Compound Name | 4-hydroxy-5-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-2-(6-hydroxy-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-trien-7-ylidene)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 91478717 |
| Molecular Formula | C29H31N2O5+ |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 4-hydroxy-5-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)-2-(6-hydroxy-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-trien-7-ylidene)cyclopentane-1,3-dione |
| SMILES | O=C1C(=c2cc3c4c(c2O)CCC[N+]=4CCC3)C(=O)C(c2cc3c4c(c2O)CCCN4CCC3)C1O |
| InChI | InChI=1S/C29H30N2O5/c32-25-17-7-3-11-30-9-1-5-15(23(17)30)13-19(25)21-27(34)22(29(36)28(21)35)20-14-16-6-2-10-31-12-4-8-18(24(16)31)26(20)33/h13-14,21,28,32,35H,1-12H2/p+1 |
| InChIKey | OULVFFCRPXXZIN-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|