C18H31N3O6 — CID 123964887
tert-butyl N-[[2-(2-hydroxy-2-methoxyethylidene)pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 123964887) has the molecular formula C18H31N3O6 and a molecular weight of 385.46 g/mol. Its IUPAC name is tert-butyl N-[[2-(2-hydroxy-2-methoxyethylidene)pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl N-[[2-(2-hydroxy-2-methoxyethylidene)pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 123964887 |
| Molecular Formula | C18H31N3O6 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | tert-butyl N-[[2-(2-hydroxy-2-methoxyethylidene)pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | COC(O)C=C1CCCN1C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N3O6/c1-17(2,3)26-15(23)19-14(20-16(24)27-18(4,5)6)21-10-8-9-12(21)11-13(22)25-7/h11,13,22H,8-10H2,1-7H3,(H,19,20,23,24) |
| InChIKey | DJEWLQBTTJSKIA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|