C9H11N — CID 123985201
7-methyl-3a,7a-dihydro-3H-indole (PubChem CID 123985201) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 7-methyl-3a,7a-dihydro-3H-indole.
| Compound Name | 7-methyl-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 123985201 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 7-methyl-3a,7a-dihydro-3H-indole |
| SMILES | CC1=CC=CC2CC=NC12 |
| InChI | InChI=1S/C9H11N/c1-7-3-2-4-8-5-6-10-9(7)8/h2-4,6,8-9H,5H2,1H3 |
| InChIKey | UQKOHRAQRNSZCN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |