C49H46F4N2O4S — CID 123985412
[[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate (PubChem CID 123985412) has the molecular formula C49H46F4N2O4S and a molecular weight of 834.98 g/mol. Its IUPAC name is [[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate.
| Compound Name | [[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 123985412 |
| Molecular Formula | C49H46F4N2O4S |
| Molecular Weight | 834.98 g/mol |
| Exact Mass | 834.31 |
| IUPAC Name | [[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=NOC(=O)c3cccs3)c3ccccc3OCC(F)(F)C(F)F)cc2c2cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c21 |
| InChI | InChI=1S/C49H46F4N2O4S/c1-6-8-14-32(7-2)27-55-40-21-20-33(44(54-59-47(57)42-19-13-22-60-42)36-17-11-12-18-41(36)58-28-49(52,53)48(50)51)25-37(40)38-26-39(34-15-9-10-16-35(34)45(38)55)46(56)43-30(4)23-29(3)24-31(43)5/h9-13,15-26,32,48H,6-8,14,27-28H2,1-5H3 |
| InChIKey | LWSREVQGAVKIEO-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.98 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|