C30H29N7O2S2 — CID 123988190
1-[3-[5-[[2-(2-cyanophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]but-1-enyl N'-[2-(2-cyanophenyl)acetyl]carbamimidothioate (PubChem CID 123988190) has the molecular formula C30H29N7O2S2 and a molecular weight of 583.74 g/mol. Its IUPAC name is 1-[3-[5-[[2-(2-cyanophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]but-1-enyl N'-[2-(2-cyanophenyl)acetyl]carbamimidothioate.
| Compound Name | 1-[3-[5-[[2-(2-cyanophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]but-1-enyl N'-[2-(2-cyanophenyl)acetyl]carbamimidothioate |
|---|---|
| PubChem CID | 123988190 |
| Molecular Formula | C30H29N7O2S2 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 1-[3-[5-[[2-(2-cyanophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]cyclopentyl]but-1-enyl N'-[2-(2-cyanophenyl)acetyl]carbamimidothioate |
| SMILES | CCC=C(S/C(N)=N/C(=O)Cc1ccccc1C#N)C1CCC(c2nnc(NC(=O)Cc3ccccc3C#N)s2)C1 |
| InChI | InChI=1S/C30H29N7O2S2/c1-2-7-25(40-29(33)34-26(38)15-19-8-3-5-10-23(19)17-31)21-12-13-22(14-21)28-36-37-30(41-28)35-27(39)16-20-9-4-6-11-24(20)18-32/h3-11,21-22H,2,12-16H2,1H3,(H2,33,34,38)(H,35,37,39) |
| InChIKey | YPWAXUGQSBXLER-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 157.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|