C22H35NO3 — CID 123989085
N-(2-hydroxyethyl)-13-(3-pentyloxiran-2-yl)trideca-2,4,6,8-tetraenamide (PubChem CID 123989085) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-13-(3-pentyloxiran-2-yl)trideca-2,4,6,8-tetraenamide.
| Compound Name | N-(2-hydroxyethyl)-13-(3-pentyloxiran-2-yl)trideca-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 123989085 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | N-(2-hydroxyethyl)-13-(3-pentyloxiran-2-yl)trideca-2,4,6,8-tetraenamide |
| SMILES | CCCCCC1OC1CCCCC=CC=CC=CC=CC(=O)NCCO |
| InChI | InChI=1S/C22H35NO3/c1-2-3-12-15-20-21(26-20)16-13-10-8-6-4-5-7-9-11-14-17-22(25)23-18-19-24/h4-7,9,11,14,17,20-21,24H,2-3,8,10,12-13,15-16,18-19H2,1H3,(H,23,25) |
| InChIKey | NRGVBWFEKVZSRC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|