C18H16F3N2O2S- — CID 123998783
4-[[1-(2,5-dimethylphenyl)-4,4,4-trifluoro-3-iminobutylidene]amino]benzenesulfinate (PubChem CID 123998783) has the molecular formula C18H16F3N2O2S- and a molecular weight of 381.40 g/mol. Its IUPAC name is 4-[[1-(2,5-dimethylphenyl)-4,4,4-trifluoro-3-iminobutylidene]amino]benzenesulfinate.
| Compound Name | 4-[[1-(2,5-dimethylphenyl)-4,4,4-trifluoro-3-iminobutylidene]amino]benzenesulfinate |
|---|---|
| PubChem CID | 123998783 |
| Molecular Formula | C18H16F3N2O2S- |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-[[1-(2,5-dimethylphenyl)-4,4,4-trifluoro-3-iminobutylidene]amino]benzenesulfinate |
| SMILES | [H]/N=C(/C/C(=N\c1ccc(S(=O)[O-])cc1)c1cc(C)ccc1C)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O2S/c1-11-3-4-12(2)15(9-11)16(10-17(22)18(19,20)21)23-13-5-7-14(8-6-13)26(24)25/h3-9,22H,10H2,1-2H3,(H,24,25)/p-1/b22-17-,23-16+ |
| InChIKey | JHYOHIIRYRUBRL-URGGOOJWSA-M |
| XLogP | 4.63 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|