C17H16F3NO4 — CID 124632173
4-[(1S)-2,5-dioxocyclohexyl]-4-oxo-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 124632173) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is 4-[(1S)-2,5-dioxocyclohexyl]-4-oxo-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-[(1S)-2,5-dioxocyclohexyl]-4-oxo-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 124632173 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-[(1S)-2,5-dioxocyclohexyl]-4-oxo-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C1CCC(=O)[C@@H](C(=O)CCC(=O)Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H16F3NO4/c18-17(19,20)10-2-1-3-11(8-10)21-16(25)7-6-15(24)13-9-12(22)4-5-14(13)23/h1-3,8,13H,4-7,9H2,(H,21,25)/t13-/m0/s1 |
| InChIKey | OZVXHSRUFARNAC-ZDUSSCGKSA-N |
| XLogP | 2.93 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|