C11H16N2O — CID 124639792
(E,1R)-1-amino-3-(4-amino-3,5-dimethylphenyl)prop-2-en-1-ol (PubChem CID 124639792) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (E,1R)-1-amino-3-(4-amino-3,5-dimethylphenyl)prop-2-en-1-ol.
| Compound Name | (E,1R)-1-amino-3-(4-amino-3,5-dimethylphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 124639792 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (E,1R)-1-amino-3-(4-amino-3,5-dimethylphenyl)prop-2-en-1-ol |
| SMILES | Cc1cc(/C=C/[C@H](N)O)cc(C)c1N |
| InChI | InChI=1S/C11H16N2O/c1-7-5-9(3-4-10(12)14)6-8(2)11(7)13/h3-6,10,14H,12-13H2,1-2H3/b4-3+/t10-/m1/s1 |
| InChIKey | FIUZLRJIMDUEJA-HMDXOVGESA-N |
| XLogP | 1.18 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|