C16H12F13N — CID 169235727
2,6-dimethyl-4-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-enyl]aniline (PubChem CID 169235727) has the molecular formula C16H12F13N and a molecular weight of 465.25 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-enyl]aniline.
| Compound Name | 2,6-dimethyl-4-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-enyl]aniline |
|---|---|
| PubChem CID | 169235727 |
| Molecular Formula | C16H12F13N |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 2,6-dimethyl-4-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-enyl]aniline |
| SMILES | Cc1cc(/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(C)c1N |
| InChI | InChI=1S/C16H12F13N/c1-7-5-9(6-8(2)10(7)30)3-4-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h3-6H,30H2,1-2H3/b4-3+ |
| InChIKey | XYLWECKLJWHAHL-ONEGZZNKSA-N |
| XLogP | 6.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|