C15H21N — CID 124676605
(4bS,8aR,9S)-4b-methyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine (PubChem CID 124676605) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (4bS,8aR,9S)-4b-methyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine.
| Compound Name | (4bS,8aR,9S)-4b-methyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine |
|---|---|
| PubChem CID | 124676605 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (4bS,8aR,9S)-4b-methyl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-9-amine |
| SMILES | C[C@]12CCCC[C@H]1[C@@H](N)Cc1ccccc12 |
| InChI | InChI=1S/C15H21N/c1-15-9-5-4-8-13(15)14(16)10-11-6-2-3-7-12(11)15/h2-3,6-7,13-14H,4-5,8-10,16H2,1H3/t13-,14-,15+/m0/s1 |
| InChIKey | ZMQWOXWLXGWFRM-SOUVJXGZSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |