C20H17N3O5S — CID 124722247
(4S,4aS,7aR)-2-amino-6-(3,4-dimethoxyphenyl)-4-(furan-2-yl)-5,7-dioxo-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-3-carbonitrile (PubChem CID 124722247) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is (4S,4aS,7aR)-2-amino-6-(3,4-dimethoxyphenyl)-4-(furan-2-yl)-5,7-dioxo-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-3-carbonitrile.
| Compound Name | (4S,4aS,7aR)-2-amino-6-(3,4-dimethoxyphenyl)-4-(furan-2-yl)-5,7-dioxo-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 124722247 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (4S,4aS,7aR)-2-amino-6-(3,4-dimethoxyphenyl)-4-(furan-2-yl)-5,7-dioxo-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-3-carbonitrile |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H](SC(N)=C(C#N)[C@H]3c3ccco3)C2=O)cc1OC |
| InChI | InChI=1S/C20H17N3O5S/c1-26-12-6-5-10(8-14(12)27-2)23-19(24)16-15(13-4-3-7-28-13)11(9-21)18(22)29-17(16)20(23)25/h3-8,15-17H,22H2,1-2H3/t15-,16+,17+/m0/s1 |
| InChIKey | QXHKDYDDTWKKLA-GVDBMIGSSA-N |
| XLogP | 2.38 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|