C22H18N2O6S — CID 96558818
(1S,13S,17S)-11-amino-6-methoxy-15-(3-methoxyphenyl)-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione (PubChem CID 96558818) has the molecular formula C22H18N2O6S and a molecular weight of 438.46 g/mol. Its IUPAC name is (1S,13S,17S)-11-amino-6-methoxy-15-(3-methoxyphenyl)-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione.
| Compound Name | (1S,13S,17S)-11-amino-6-methoxy-15-(3-methoxyphenyl)-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione |
|---|---|
| PubChem CID | 96558818 |
| Molecular Formula | C22H18N2O6S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (1S,13S,17S)-11-amino-6-methoxy-15-(3-methoxyphenyl)-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione |
| SMILES | COc1cccc(N2C(=O)[C@H]3[C@H](SC(N)=C4C(=O)Oc5c(OC)cccc5[C@@H]43)C2=O)c1 |
| InChI | InChI=1S/C22H18N2O6S/c1-28-11-6-3-5-10(9-11)24-20(25)15-14-12-7-4-8-13(29-2)17(12)30-22(27)16(14)19(23)31-18(15)21(24)26/h3-9,14-15,18H,23H2,1-2H3/t14-,15-,18+/m1/s1 |
| InChIKey | UNZYQERRJYJOOV-RKVPGOIHSA-N |
| XLogP | 2.18 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|