C23H19N3O6S — CID 100821828
4-[(1R,13R,17R)-11-amino-6-methoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]-N-methylbenzamide (PubChem CID 100821828) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is 4-[(1R,13R,17R)-11-amino-6-methoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]-N-methylbenzamide.
| Compound Name | 4-[(1R,13R,17R)-11-amino-6-methoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 100821828 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-[(1R,13R,17R)-11-amino-6-methoxy-9,14,16-trioxo-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-15-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H](SC(N)=C4C(=O)Oc5c(OC)cccc5[C@H]43)C2=O)cc1 |
| InChI | InChI=1S/C23H19N3O6S/c1-25-20(27)10-6-8-11(9-7-10)26-21(28)15-14-12-4-3-5-13(31-2)17(12)32-23(30)16(14)19(24)33-18(15)22(26)29/h3-9,14-15,18H,24H2,1-2H3,(H,25,27)/t14-,15-,18+/m0/s1 |
| InChIKey | REXNQECAGLTLRP-RLFYNMQTSA-N |
| XLogP | 1.53 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|