C23H20N2O7S — CID 98199634
(1S,13R,17R)-11-amino-15-(3,4-dimethoxyphenyl)-6-methoxy-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione (PubChem CID 98199634) has the molecular formula C23H20N2O7S and a molecular weight of 468.49 g/mol. Its IUPAC name is (1S,13R,17R)-11-amino-15-(3,4-dimethoxyphenyl)-6-methoxy-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione.
| Compound Name | (1S,13R,17R)-11-amino-15-(3,4-dimethoxyphenyl)-6-methoxy-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione |
|---|---|
| PubChem CID | 98199634 |
| Molecular Formula | C23H20N2O7S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (1S,13R,17R)-11-amino-15-(3,4-dimethoxyphenyl)-6-methoxy-8-oxa-12-thia-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-9,14,16-trione |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H]4C(=C(N)S[C@H]3C2=O)C(=O)Oc2c(OC)cccc24)cc1OC |
| InChI | InChI=1S/C23H20N2O7S/c1-29-12-8-7-10(9-14(12)31-3)25-21(26)16-15-11-5-4-6-13(30-2)18(11)32-23(28)17(15)20(24)33-19(16)22(25)27/h4-9,15-16,19H,24H2,1-3H3/t15-,16+,19-/m1/s1 |
| InChIKey | ZTKUTOGHUQFHBD-JTDSTZFVSA-N |
| XLogP | 2.19 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|