C24H19N3O4S — CID 51671767
(4S,4aR,7aS)-2-amino-4-(2-hydroxyphenyl)-6-naphthalen-2-yl-5,7-dioxo-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-3-carboxamide (PubChem CID 51671767) has the molecular formula C24H19N3O4S and a molecular weight of 445.50 g/mol. Its IUPAC name is (4S,4aR,7aS)-2-amino-4-(2-hydroxyphenyl)-6-naphthalen-2-yl-5,7-dioxo-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-3-carboxamide.
| Compound Name | (4S,4aR,7aS)-2-amino-4-(2-hydroxyphenyl)-6-naphthalen-2-yl-5,7-dioxo-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 51671767 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | (4S,4aR,7aS)-2-amino-4-(2-hydroxyphenyl)-6-naphthalen-2-yl-5,7-dioxo-4a,7a-dihydro-4H-thiopyrano[2,3-c]pyrrole-3-carboxamide |
| SMILES | NC(=O)C1=C(N)S[C@@H]2C(=O)N(c3ccc4ccccc4c3)C(=O)[C@H]2[C@H]1c1ccccc1O |
| InChI | InChI=1S/C24H19N3O4S/c25-21(29)19-17(15-7-3-4-8-16(15)28)18-20(32-22(19)26)24(31)27(23(18)30)14-10-9-12-5-1-2-6-13(12)11-14/h1-11,17-18,20,28H,26H2,(H2,25,29)/t17-,18+,20+/m1/s1 |
| InChIKey | LNLNNOKYZLOYAG-HBFSDRIKSA-N |
| XLogP | 2.59 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|