C20H34N4O3 — CID 124734015
tert-butyl (4S)-4-[3-methoxypropyl(pyrimidin-5-ylmethyl)amino]azepane-1-carboxylate (PubChem CID 124734015) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is tert-butyl (4S)-4-[3-methoxypropyl(pyrimidin-5-ylmethyl)amino]azepane-1-carboxylate.
| Compound Name | tert-butyl (4S)-4-[3-methoxypropyl(pyrimidin-5-ylmethyl)amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 124734015 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | tert-butyl (4S)-4-[3-methoxypropyl(pyrimidin-5-ylmethyl)amino]azepane-1-carboxylate |
| SMILES | COCCCN(Cc1cncnc1)[C@H]1CCCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H34N4O3/c1-20(2,3)27-19(25)23-9-5-7-18(8-11-23)24(10-6-12-26-4)15-17-13-21-16-22-14-17/h13-14,16,18H,5-12,15H2,1-4H3/t18-/m0/s1 |
| InChIKey | LVCXVFSXASMGDI-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|