C14H23N3OS2 — CID 124738832
1-[2-[[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]methyl]-1,3-thiazol-5-yl]-N,N-dimethylmethanamine (PubChem CID 124738832) has the molecular formula C14H23N3OS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-[2-[[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]methyl]-1,3-thiazol-5-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]methyl]-1,3-thiazol-5-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 124738832 |
| Molecular Formula | C14H23N3OS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-[2-[[(4aR,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]methyl]-1,3-thiazol-5-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cnc(CN2CCS[C@H]3COCC[C@@H]32)s1 |
| InChI | InChI=1S/C14H23N3OS2/c1-16(2)8-11-7-15-14(20-11)9-17-4-6-19-13-10-18-5-3-12(13)17/h7,12-13H,3-6,8-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | RSFSCGHFAPOKDX-STQMWFEESA-N |
| XLogP | 1.91 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |