C15H21N3O4S2 — CID 124740758
N-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]-2,4-bis(methylsulfonyl)aniline (PubChem CID 124740758) has the molecular formula C15H21N3O4S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 124740758 |
| Molecular Formula | C15H21N3O4S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]-2,4-bis(methylsulfonyl)aniline |
| SMILES | CC(C)[C@H](Nc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O)c1ncc[nH]1 |
| InChI | InChI=1S/C15H21N3O4S2/c1-10(2)14(15-16-7-8-17-15)18-12-6-5-11(23(3,19)20)9-13(12)24(4,21)22/h5-10,14,18H,1-4H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | UXPGKPPYSHVILX-AWEZNQCLSA-N |
| XLogP | 2.03 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |