C25H28N2O5S — CID 124742576
methyl (2S,3aR,7aR)-1-[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 124742576) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is methyl (2S,3aR,7aR)-1-[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,7aR)-1-[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 124742576 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | methyl (2S,3aR,7aR)-1-[3-(2,3-dihydroindol-1-ylsulfonyl)benzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2CCCC[C@H]2N1C(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C25H28N2O5S/c1-32-25(29)23-16-18-8-3-5-12-22(18)27(23)24(28)19-9-6-10-20(15-19)33(30,31)26-14-13-17-7-2-4-11-21(17)26/h2,4,6-7,9-11,15,18,22-23H,3,5,8,12-14,16H2,1H3/t18-,22-,23+/m1/s1 |
| InChIKey | YDDKETCTGDMQKW-YSZBQJHXSA-N |
| XLogP | 3.38 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |