C28H36N4O13S4 — CID 124779699
4-[4,6,8-tris(morpholin-4-ylsulfonyl)dibenzofuran-2-yl]sulfonylmorpholine (PubChem CID 124779699) has the molecular formula C28H36N4O13S4 and a molecular weight of 764.88 g/mol. Its IUPAC name is 4-[4,6,8-tris(morpholin-4-ylsulfonyl)dibenzofuran-2-yl]sulfonylmorpholine.
| Compound Name | 4-[4,6,8-tris(morpholin-4-ylsulfonyl)dibenzofuran-2-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 124779699 |
| Molecular Formula | C28H36N4O13S4 |
| Molecular Weight | 764.88 g/mol |
| Exact Mass | 764.12 |
| IUPAC Name | 4-[4,6,8-tris(morpholin-4-ylsulfonyl)dibenzofuran-2-yl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1cc(S(=O)(=O)N2CCOCC2)c2oc3c(S(=O)(=O)N4CCOCC4)cc(S(=O)(=O)N4CCOCC4)cc3c2c1)N1CCOCC1 |
| InChI | InChI=1S/C28H36N4O13S4/c33-46(34,29-1-9-41-10-2-29)21-17-23-24-18-22(47(35,36)30-3-11-42-12-4-30)20-26(49(39,40)32-7-15-44-16-8-32)28(24)45-27(23)25(19-21)48(37,38)31-5-13-43-14-6-31/h17-20H,1-16H2 |
| InChIKey | QJZIYSNBIRMTKU-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 199.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.88 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |