C34H29NS — CID 124865393
(2S,4R)-3-benzyl-2,4,5,5-tetraphenyl-1,3-thiazolidine (PubChem CID 124865393) has the molecular formula C34H29NS and a molecular weight of 483.68 g/mol. Its IUPAC name is (2S,4R)-3-benzyl-2,4,5,5-tetraphenyl-1,3-thiazolidine.
| Compound Name | (2S,4R)-3-benzyl-2,4,5,5-tetraphenyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 124865393 |
| Molecular Formula | C34H29NS |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (2S,4R)-3-benzyl-2,4,5,5-tetraphenyl-1,3-thiazolidine |
| SMILES | c1ccc(CN2[C@H](c3ccccc3)SC(c3ccccc3)(c3ccccc3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C34H29NS/c1-6-16-27(17-7-1)26-35-32(28-18-8-2-9-19-28)34(30-22-12-4-13-23-30,31-24-14-5-15-25-31)36-33(35)29-20-10-3-11-21-29/h1-25,32-33H,26H2/t32-,33+/m1/s1 |
| InChIKey | LZBMMFQTIDLMFA-SAIUNTKASA-N |
| XLogP | 8.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |