C28H44N2O4 — CID 124904098
CID 124904098 (PubChem CID 124904098) has the molecular formula C28H44N2O4 and a molecular weight of 472.67 g/mol.
| Compound Name | CID 124904098 |
|---|---|
| PubChem CID | 124904098 |
| Molecular Formula | C28H44N2O4 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | — |
| SMILES | CCNC(=O)N1C[C@@]2(CC[C@@H]3[C@@H]4CC=C5CC6(CC[C@]5(C)[C@H]4CC[C@@]32C)OCCO6)OC1(C)C |
| InChI | InChI=1S/C28H44N2O4/c1-6-29-23(31)30-18-27(34-24(30,2)3)12-10-22-20-8-7-19-17-28(32-15-16-33-28)14-13-25(19,4)21(20)9-11-26(22,27)5/h7,20-22H,6,8-18H2,1-5H3,(H,29,31)/t20-,21+,22-,25+,26+,27-/m1/s1 |
| InChIKey | AUHGSFJWFOFKRZ-JRMZZVOVSA-N |
| XLogP | 5.23 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|