C20H4Cl16 — CID 124923690
(1S,2S,3S,4R,7R,8S,15R,16S)-1,4,5,6,7,10,11,12,13,16,17,18,19,19,20,20-hexadecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9(14),10,12,17-pentaene (PubChem CID 124923690) has the molecular formula C20H4Cl16 and a molecular weight of 811.50 g/mol. Its IUPAC name is (1S,2S,3S,4R,7R,8S,15R,16S)-1,4,5,6,7,10,11,12,13,16,17,18,19,19,20,20-hexadecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9(14),10,12,17-pentaene.
| Compound Name | (1S,2S,3S,4R,7R,8S,15R,16S)-1,4,5,6,7,10,11,12,13,16,17,18,19,19,20,20-hexadecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9(14),10,12,17-pentaene |
|---|---|
| PubChem CID | 124923690 |
| Molecular Formula | C20H4Cl16 |
| Molecular Weight | 811.50 g/mol |
| Exact Mass | 803.53 |
| IUPAC Name | (1S,2S,3S,4R,7R,8S,15R,16S)-1,4,5,6,7,10,11,12,13,16,17,18,19,19,20,20-hexadecachlorohexacyclo[14.2.1.14,7.02,15.03,8.09,14]icosa-5,9(14),10,12,17-pentaene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@H]3c4c(Cl)c(Cl)c(Cl)c(Cl)c4[C@@H]4[C@H]([C@@H]3[C@@]1(Cl)C2(Cl)Cl)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]4(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C20H4Cl16/c21-7-1-2(8(22)10(24)9(7)23)4-6(18(32)14(28)12(26)16(4,30)20(18,35)36)5-3(1)15(29)11(25)13(27)17(5,31)19(15,33)34/h3-6H/t3-,4+,5-,6-,15-,16+,17-,18+/m1/s1 |
| InChIKey | TYLICGTWUJQTQZ-CNBYMXDUSA-N |
| XLogP | 12.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.50 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|