C9H8Cl2N2O3S — CID 124927904
O-(2,4-dichloro-5-nitrophenyl) N-ethylcarbamothioate (PubChem CID 124927904) has the molecular formula C9H8Cl2N2O3S and a molecular weight of 295.15 g/mol. Its IUPAC name is O-(2,4-dichloro-5-nitrophenyl) N-ethylcarbamothioate.
| Compound Name | O-(2,4-dichloro-5-nitrophenyl) N-ethylcarbamothioate |
|---|---|
| PubChem CID | 124927904 |
| Molecular Formula | C9H8Cl2N2O3S |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | O-(2,4-dichloro-5-nitrophenyl) N-ethylcarbamothioate |
| SMILES | CCNC(=S)Oc1cc([N+](=O)[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2N2O3S/c1-2-12-9(17)16-8-4-7(13(14)15)5(10)3-6(8)11/h3-4H,2H2,1H3,(H,12,17) |
| InChIKey | URSVSSGXXJUWOU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|