C35H34N+ — CID 124935870
(1S,2R,4S,5S)-1-(anthracen-9-ylmethyl)-5-ethenyl-2-(naphthalen-1-ylmethyl)-1-azoniabicyclo[2.2.2]octane (PubChem CID 124935870) has the molecular formula C35H34N+ and a molecular weight of 468.66 g/mol. Its IUPAC name is (1S,2R,4S,5S)-1-(anthracen-9-ylmethyl)-5-ethenyl-2-(naphthalen-1-ylmethyl)-1-azoniabicyclo[2.2.2]octane.
| Compound Name | (1S,2R,4S,5S)-1-(anthracen-9-ylmethyl)-5-ethenyl-2-(naphthalen-1-ylmethyl)-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 124935870 |
| Molecular Formula | C35H34N+ |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (1S,2R,4S,5S)-1-(anthracen-9-ylmethyl)-5-ethenyl-2-(naphthalen-1-ylmethyl)-1-azoniabicyclo[2.2.2]octane |
| SMILES | C=C[C@@H]1C[N@+]2(Cc3c4ccccc4cc4ccccc34)CC[C@H]1C[C@@H]2Cc1cccc2ccccc12 |
| InChI | InChI=1S/C35H34N/c1-2-25-23-36(24-35-33-16-7-4-11-28(33)20-29-12-5-8-17-34(29)35)19-18-27(25)21-31(36)22-30-14-9-13-26-10-3-6-15-32(26)30/h2-17,20,25,27,31H,1,18-19,21-24H2/q+1/t25-,27+,31-,36+/m1/s1 |
| InChIKey | JNGYZNIKXLUCOS-VMLWRPQUSA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|