C22H33NO2 — CID 125022317
(3S,4aS,5S,10bS)-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-pyrrolidine] (PubChem CID 125022317) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (3S,4aS,5S,10bS)-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-pyrrolidine].
| Compound Name | (3S,4aS,5S,10bS)-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-pyrrolidine] |
|---|---|
| PubChem CID | 125022317 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (3S,4aS,5S,10bS)-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-pyrrolidine] |
| SMILES | CC(C)CCC[C@]1(C)Oc2ccccc2[C@H]2OC[C@]3(CCCN3)C[C@@H]21 |
| InChI | InChI=1S/C22H33NO2/c1-16(2)8-6-11-21(3)18-14-22(12-7-13-23-22)15-24-20(18)17-9-4-5-10-19(17)25-21/h4-5,9-10,16,18,20,23H,6-8,11-15H2,1-3H3/t18-,20+,21-,22-/m0/s1 |
| InChIKey | YPUZPBNINFBEJG-FKVLARQCSA-N |
| XLogP | 4.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |