C12H11Cl — CID 125027624
(1R,2R,5R,6R,7E)-3-chlorotricyclo[4.4.2.02,5]dodeca-3,7,9,11-tetraene (PubChem CID 125027624) has the molecular formula C12H11Cl and a molecular weight of 190.67 g/mol. Its IUPAC name is (1R,2R,5R,6R,7E)-3-chlorotricyclo[4.4.2.02,5]dodeca-3,7,9,11-tetraene.
| Compound Name | (1R,2R,5R,6R,7E)-3-chlorotricyclo[4.4.2.02,5]dodeca-3,7,9,11-tetraene |
|---|---|
| PubChem CID | 125027624 |
| Molecular Formula | C12H11Cl |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (1R,2R,5R,6R,7E)-3-chlorotricyclo[4.4.2.02,5]dodeca-3,7,9,11-tetraene |
| SMILES | ClC1=C[C@@H]2[C@H]1[C@@H]1C=C/C=C\[C@@H]2C=C1 |
| InChI | InChI=1S/C12H11Cl/c13-11-7-10-8-3-1-2-4-9(6-5-8)12(10)11/h1-10,12H/b3-1-,4-2?/t8-,9-,10+,12-/m1/s1 |
| InChIKey | GQWKGKPBZQJYJG-RTORGUGNSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|