C16H10Cl3NO3 — CID 3566397
2-oxo-N-(2,4,5-trichlorophenyl)-4a,8a-dihydrochromene-3-carboxamide (PubChem CID 3566397) has the molecular formula C16H10Cl3NO3 and a molecular weight of 370.62 g/mol. Its IUPAC name is 2-oxo-N-(2,4,5-trichlorophenyl)-4a,8a-dihydrochromene-3-carboxamide.
| Compound Name | 2-oxo-N-(2,4,5-trichlorophenyl)-4a,8a-dihydrochromene-3-carboxamide |
|---|---|
| PubChem CID | 3566397 |
| Molecular Formula | C16H10Cl3NO3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 2-oxo-N-(2,4,5-trichlorophenyl)-4a,8a-dihydrochromene-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1=CC2C=CC=CC2OC1=O |
| InChI | InChI=1S/C16H10Cl3NO3/c17-10-6-12(19)13(7-11(10)18)20-15(21)9-5-8-3-1-2-4-14(8)23-16(9)22/h1-8,14H,(H,20,21) |
| InChIKey | DCTJDWIKKVXDKE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|