C21H36O2S2Si — CID 125034440
(1R,3aR,5aR,7S,9aS)-7-[tert-butyl(dimethyl)silyl]oxyspiro[1,2,3,3a,5,5a,6,7-octahydrocyclopenta[i]indene-4,2'-1,3-dithiane]-1-ol (PubChem CID 125034440) has the molecular formula C21H36O2S2Si and a molecular weight of 412.74 g/mol. Its IUPAC name is (1R,3aR,5aR,7S,9aS)-7-[tert-butyl(dimethyl)silyl]oxyspiro[1,2,3,3a,5,5a,6,7-octahydrocyclopenta[i]indene-4,2'-1,3-dithiane]-1-ol.
| Compound Name | (1R,3aR,5aR,7S,9aS)-7-[tert-butyl(dimethyl)silyl]oxyspiro[1,2,3,3a,5,5a,6,7-octahydrocyclopenta[i]indene-4,2'-1,3-dithiane]-1-ol |
|---|---|
| PubChem CID | 125034440 |
| Molecular Formula | C21H36O2S2Si |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (1R,3aR,5aR,7S,9aS)-7-[tert-butyl(dimethyl)silyl]oxyspiro[1,2,3,3a,5,5a,6,7-octahydrocyclopenta[i]indene-4,2'-1,3-dithiane]-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C[C@@]23[C@H](C1)CC1(SCCCS1)[C@@H]2CC[C@H]3O |
| InChI | InChI=1S/C21H36O2S2Si/c1-19(2,3)26(4,5)23-16-9-10-20-15(13-16)14-21(24-11-6-12-25-21)17(20)7-8-18(20)22/h9-10,15-18,22H,6-8,11-14H2,1-5H3/t15-,16-,17-,18-,20-/m1/s1 |
| InChIKey | JMLGRMQWNSLYPW-HGJKNBTDSA-N |
| XLogP | 5.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|