C17H32O2S2Si — CID 134938923
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-cyclopropyl-6,10-dithiaspiro[4.5]decan-4-ol (PubChem CID 134938923) has the molecular formula C17H32O2S2Si and a molecular weight of 360.66 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-cyclopropyl-6,10-dithiaspiro[4.5]decan-4-ol.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-cyclopropyl-6,10-dithiaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 134938923 |
| Molecular Formula | C17H32O2S2Si |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-cyclopropyl-6,10-dithiaspiro[4.5]decan-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC2(SCCCS2)C(O)(C2CC2)C1 |
| InChI | InChI=1S/C17H32O2S2Si/c1-15(2,3)22(4,5)19-14-11-16(18,13-7-8-13)17(12-14)20-9-6-10-21-17/h13-14,18H,6-12H2,1-5H3/t14-,16?/m1/s1 |
| InChIKey | PJCMYCJXAGCBMK-IURRXHLWSA-N |
| XLogP | 4.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|