C20H32O4Si — CID 125034934
(1S,10S,12S,14S,16R)-16-[tert-butyl(dimethyl)silyl]oxy-5,13-dioxatetracyclo[8.5.1.01,7.012,14]hexadec-6-en-4-one (PubChem CID 125034934) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is (1S,10S,12S,14S,16R)-16-[tert-butyl(dimethyl)silyl]oxy-5,13-dioxatetracyclo[8.5.1.01,7.012,14]hexadec-6-en-4-one.
| Compound Name | (1S,10S,12S,14S,16R)-16-[tert-butyl(dimethyl)silyl]oxy-5,13-dioxatetracyclo[8.5.1.01,7.012,14]hexadec-6-en-4-one |
|---|---|
| PubChem CID | 125034934 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | (1S,10S,12S,14S,16R)-16-[tert-butyl(dimethyl)silyl]oxy-5,13-dioxatetracyclo[8.5.1.01,7.012,14]hexadec-6-en-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H]2CCC3=COC(=O)CC[C@]31C[C@@H]1O[C@H]1C2 |
| InChI | InChI=1S/C20H32O4Si/c1-19(2,3)25(4,5)24-18-13-6-7-14-12-22-17(21)8-9-20(14,18)11-16-15(10-13)23-16/h12-13,15-16,18H,6-11H2,1-5H3/t13-,15-,16-,18+,20-/m0/s1 |
| InChIKey | MMPJTBVUGCNJGF-KZTUBPIMSA-N |
| XLogP | 4.56 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|