C25H44O5Si — CID 117069656
(3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3-methyltricyclo[7.4.1.01,6]tetradec-5-en-12-one (PubChem CID 117069656) has the molecular formula C25H44O5Si and a molecular weight of 452.71 g/mol. Its IUPAC name is (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3-methyltricyclo[7.4.1.01,6]tetradec-5-en-12-one.
| Compound Name | (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3-methyltricyclo[7.4.1.01,6]tetradec-5-en-12-one |
|---|---|
| PubChem CID | 117069656 |
| Molecular Formula | C25H44O5Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | (3R,4S)-14-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-3-methyltricyclo[7.4.1.01,6]tetradec-5-en-12-one |
| SMILES | COCCOCO[C@@H]1C=C2CCC3CCC(=O)CC2(C[C@H]1C)C3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O5Si/c1-18-15-25-16-21(26)11-9-19(23(25)30-31(6,7)24(2,3)4)8-10-20(25)14-22(18)29-17-28-13-12-27-5/h14,18-19,22-23H,8-13,15-17H2,1-7H3/t18-,19?,22-,23?,25?/m1/s1 |
| InChIKey | PRZVFUFBVMEGBV-JZQSQWBRSA-N |
| XLogP | 5.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|