C26H44O5Si — CID 99958815
(1S,4S,9S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-13,13-dimethyltricyclo[7.4.1.01,6]tetradeca-5,10-dien-12-one (PubChem CID 99958815) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is (1S,4S,9S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-13,13-dimethyltricyclo[7.4.1.01,6]tetradeca-5,10-dien-12-one.
| Compound Name | (1S,4S,9S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-13,13-dimethyltricyclo[7.4.1.01,6]tetradeca-5,10-dien-12-one |
|---|---|
| PubChem CID | 99958815 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (1S,4S,9S,14S)-14-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-13,13-dimethyltricyclo[7.4.1.01,6]tetradeca-5,10-dien-12-one |
| SMILES | COCCOCO[C@@H]1C=C2CC[C@H]3C=CC(=O)C(C)(C)[C@@]2(CC1)[C@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O5Si/c1-24(2,3)32(7,8)31-23-19-9-11-20-17-21(30-18-29-16-15-28-6)13-14-26(20,23)25(4,5)22(27)12-10-19/h10,12,17,19,21,23H,9,11,13-16,18H2,1-8H3/t19-,21-,23-,26+/m0/s1 |
| InChIKey | KHYJJZUWANIJMG-MDJJAXGLSA-N |
| XLogP | 5.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|