C19H40O5SSi — CID 10669202
tert-butyl-[[(1S,2R,4R)-4-(2-methoxyethoxymethoxy)-2-(methylsulfanylmethoxymethyl)cyclopentyl]methoxy]-dimethylsilane (PubChem CID 10669202) has the molecular formula C19H40O5SSi and a molecular weight of 408.68 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,4R)-4-(2-methoxyethoxymethoxy)-2-(methylsulfanylmethoxymethyl)cyclopentyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,4R)-4-(2-methoxyethoxymethoxy)-2-(methylsulfanylmethoxymethyl)cyclopentyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10669202 |
| Molecular Formula | C19H40O5SSi |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | tert-butyl-[[(1S,2R,4R)-4-(2-methoxyethoxymethoxy)-2-(methylsulfanylmethoxymethyl)cyclopentyl]methoxy]-dimethylsilane |
| SMILES | COCCOCO[C@@H]1C[C@@H](COCSC)[C@@H](CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H40O5SSi/c1-19(2,3)26(6,7)24-13-17-11-18(23-14-21-9-8-20-4)10-16(17)12-22-15-25-5/h16-18H,8-15H2,1-7H3/t16-,17+,18+/m0/s1 |
| InChIKey | DORGAPHAXSCTAO-RCCFBDPRSA-N |
| XLogP | 4.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|