C14H18ClN2O+ — CID 125115465
1-[(4-chlorophenyl)methyl]-3-(propan-2-yloxymethyl)imidazol-1-ium (PubChem CID 125115465) has the molecular formula C14H18ClN2O+ and a molecular weight of 265.76 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(propan-2-yloxymethyl)imidazol-1-ium.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(propan-2-yloxymethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 125115465 |
| Molecular Formula | C14H18ClN2O+ |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(propan-2-yloxymethyl)imidazol-1-ium |
| SMILES | CC(C)OCn1cc[n+](Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C14H18ClN2O/c1-12(2)18-11-17-8-7-16(10-17)9-13-3-5-14(15)6-4-13/h3-8,10,12H,9,11H2,1-2H3/q+1 |
| InChIKey | VPYZIVRSGVITIB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|