C30H28N4O3S — CID 125117496
3-[2-[(4E)-4-[(4-tert-butylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylethyl]-1H-quinazoline-2,4-dione (PubChem CID 125117496) has the molecular formula C30H28N4O3S and a molecular weight of 524.65 g/mol. Its IUPAC name is 3-[2-[(4E)-4-[(4-tert-butylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylethyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-[(4E)-4-[(4-tert-butylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylethyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 125117496 |
| Molecular Formula | C30H28N4O3S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 3-[2-[(4E)-4-[(4-tert-butylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylethyl]-1H-quinazoline-2,4-dione |
| SMILES | CC(C)(C)c1ccc(/C=C2/N=C(SCCn3c(=O)[nH]c4ccccc4c3=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C30H28N4O3S/c1-30(2,3)21-15-13-20(14-16-21)19-25-27(36)34(22-9-5-4-6-10-22)29(32-25)38-18-17-33-26(35)23-11-7-8-12-24(23)31-28(33)37/h4-16,19H,17-18H2,1-3H3,(H,31,37)/b25-19+ |
| InChIKey | FMEQIKALDGLIEN-NCELDCMTSA-N |
| XLogP | 5.16 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|