C31H29N3O3S — CID 125117952
2-[3-[(4E)-4-[(4-tert-butylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione (PubChem CID 125117952) has the molecular formula C31H29N3O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[3-[(4E)-4-[(4-tert-butylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(4E)-4-[(4-tert-butylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 125117952 |
| Molecular Formula | C31H29N3O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 2-[3-[(4E)-4-[(4-tert-butylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylpropyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)c1ccc(/C=C2/N=C(SCCCN3C(=O)c4ccccc4C3=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C31H29N3O3S/c1-31(2,3)22-16-14-21(15-17-22)20-26-29(37)34(23-10-5-4-6-11-23)30(32-26)38-19-9-18-33-27(35)24-12-7-8-13-25(24)28(33)36/h4-8,10-17,20H,9,18-19H2,1-3H3/b26-20+ |
| InChIKey | ZJLFGRIKFWIADK-LHLOQNFPSA-N |
| XLogP | 6.15 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|