C12H16F2N2O3S2 — CID 125143860
4-(difluoromethylsulfanyl)-N-(4-sulfamoylbutyl)benzamide (PubChem CID 125143860) has the molecular formula C12H16F2N2O3S2 and a molecular weight of 338.40 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-(4-sulfamoylbutyl)benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-(4-sulfamoylbutyl)benzamide |
|---|---|
| PubChem CID | 125143860 |
| Molecular Formula | C12H16F2N2O3S2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-(4-sulfamoylbutyl)benzamide |
| SMILES | NS(=O)(=O)CCCCNC(=O)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C12H16F2N2O3S2/c13-12(14)20-10-5-3-9(4-6-10)11(17)16-7-1-2-8-21(15,18)19/h3-6,12H,1-2,7-8H2,(H,16,17)(H2,15,18,19) |
| InChIKey | IOLVAUAXYVGESR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|