C15H21ClN2O3 — CID 125146148
N-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-2-[[(2R)-oxolan-2-yl]methylamino]acetamide (PubChem CID 125146148) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-2-[[(2R)-oxolan-2-yl]methylamino]acetamide.
| Compound Name | N-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-2-[[(2R)-oxolan-2-yl]methylamino]acetamide |
|---|---|
| PubChem CID | 125146148 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[(2S)-2-(2-chlorophenyl)-2-hydroxyethyl]-2-[[(2R)-oxolan-2-yl]methylamino]acetamide |
| SMILES | O=C(CNC[C@H]1CCCO1)NC[C@@H](O)c1ccccc1Cl |
| InChI | InChI=1S/C15H21ClN2O3/c16-13-6-2-1-5-12(13)14(19)9-18-15(20)10-17-8-11-4-3-7-21-11/h1-2,5-6,11,14,17,19H,3-4,7-10H2,(H,18,20)/t11-,14-/m1/s1 |
| InChIKey | FAUUEJMKOSUBIX-BXUZGUMPSA-N |
| XLogP | 1.26 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |