C15H21NO4 — CID 125170714
1-(furan-2-yl)-2-[4-[(2S)-1-methoxypropan-2-yl]piperidin-1-yl]ethane-1,2-dione (PubChem CID 125170714) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[4-[(2S)-1-methoxypropan-2-yl]piperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(furan-2-yl)-2-[4-[(2S)-1-methoxypropan-2-yl]piperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 125170714 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-(furan-2-yl)-2-[4-[(2S)-1-methoxypropan-2-yl]piperidin-1-yl]ethane-1,2-dione |
| SMILES | COC[C@@H](C)C1CCN(C(=O)C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C15H21NO4/c1-11(10-19-2)12-5-7-16(8-6-12)15(18)14(17)13-4-3-9-20-13/h3-4,9,11-12H,5-8,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | JZSNUOBTYSWKJJ-LLVKDONJSA-N |
| XLogP | 1.98 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|