C20H24N4O3S — CID 125224955
1-[(2R,6R)-12-anilino-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]-3-methylbutan-1-one (PubChem CID 125224955) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 1-[(2R,6R)-12-anilino-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(2R,6R)-12-anilino-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 125224955 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[(2R,6R)-12-anilino-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1C[C@@H]2c3nc(Nc4ccccc4)ncc3CS(=O)(=O)[C@H]2C1 |
| InChI | InChI=1S/C20H24N4O3S/c1-13(2)8-18(25)24-10-16-17(11-24)28(26,27)12-14-9-21-20(23-19(14)16)22-15-6-4-3-5-7-15/h3-7,9,13,16-17H,8,10-12H2,1-2H3,(H,21,22,23)/t16-,17-/m0/s1 |
| InChIKey | QVOAWROHXCSKGU-IRXDYDNUSA-N |
| XLogP | 2.49 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |