C20H23FN4O2S — CID 155902751
(2R,6S)-N-(cyclopropylmethyl)-4-[(2-fluorophenyl)methyl]-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine (PubChem CID 155902751) has the molecular formula C20H23FN4O2S and a molecular weight of 402.50 g/mol. Its IUPAC name is (2R,6S)-N-(cyclopropylmethyl)-4-[(2-fluorophenyl)methyl]-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine.
| Compound Name | (2R,6S)-N-(cyclopropylmethyl)-4-[(2-fluorophenyl)methyl]-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine |
|---|---|
| PubChem CID | 155902751 |
| Molecular Formula | C20H23FN4O2S |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2R,6S)-N-(cyclopropylmethyl)-4-[(2-fluorophenyl)methyl]-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine |
| SMILES | O=S1(=O)Cc2cnc(NCC3CC3)nc2[C@H]2CN(Cc3ccccc3F)C[C@H]21 |
| InChI | InChI=1S/C20H23FN4O2S/c21-17-4-2-1-3-14(17)9-25-10-16-18(11-25)28(26,27)12-15-8-23-20(24-19(15)16)22-7-13-5-6-13/h1-4,8,13,16,18H,5-7,9-12H2,(H,22,23,24)/t16-,18+/m0/s1 |
| InChIKey | GDCYFOLBISYYDO-FUHWJXTLSA-N |
| XLogP | 2.33 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |