C8H9NO — CID 12538207
2-amino-6-methylcyclohepta-2,4,6-trien-1-one (PubChem CID 12538207) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-amino-6-methylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-amino-6-methylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 12538207 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-amino-6-methylcyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1cccc(N)c(=O)c1 |
| InChI | InChI=1S/C8H9NO/c1-6-3-2-4-7(9)8(10)5-6/h2-5H,1H3,(H2,9,10) |
| InChIKey | OFULOUCOKJONNH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |